![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Biological Control of Pests-344.doc | 10-Nov-2011 08:26 | 149K | |
| Chemical Pest Control-313.doc | 10-Nov-2011 08:26 | 84K | |
| Cultural Pest Control-312.doc | 10-Nov-2011 08:26 | 51K | |
| Fundamentals of Insect Study-048.doc | 10-Nov-2011 08:26 | 125K | |
| Insect Management in Rice Production-028.doc | 10-Nov-2011 08:26 | 133K | |
| Insect Pest Management-052.doc | 10-Nov-2011 08:26 | 86K | |
| Pyrethrum A Bio-pesticide-485.doc | 10-Nov-2011 08:26 | 52K | |
| Rodent and Other Vertebrate Control-316.doc | 10-Nov-2011 08:26 | 83K | |
| Safe Use of Agro-chemicals-523.doc | 10-Nov-2011 08:26 | 209K | |
| Safe Use of Pesticides-196.doc | 10-Nov-2011 08:26 | 112K | |